C27H31ClO5S — CID 10029056
7-[(1R,4S,5R)-5-[(Z)-5-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-4-hydroxy-3,3-dimethyl-2-oxocyclopentyl]hept-5-ynoic acid (PubChem CID 10029056) has the molecular formula C27H31ClO5S and a molecular weight of 503.06 g/mol. Its IUPAC name is 7-[(1R,4S,5R)-5-[(Z)-5-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-4-hydroxy-3,3-dimethyl-2-oxocyclopentyl]hept-5-ynoic acid.
| Compound Name | 7-[(1R,4S,5R)-5-[(Z)-5-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-4-hydroxy-3,3-dimethyl-2-oxocyclopentyl]hept-5-ynoic acid |
|---|---|
| PubChem CID | 10029056 |
| Molecular Formula | C27H31ClO5S |
| Molecular Weight | 503.06 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | 7-[(1R,4S,5R)-5-[(Z)-5-(3-chloro-1-benzothiophen-2-yl)-3-hydroxypent-1-enyl]-4-hydroxy-3,3-dimethyl-2-oxocyclopentyl]hept-5-ynoic acid |
| SMILES | CC1(C)C(=O)[C@H](CC#CCCCC(=O)O)[C@@H](/C=C\C(O)CCc2sc3ccccc3c2Cl)[C@@H]1O |
| InChI | InChI=1S/C27H31ClO5S/c1-27(2)25(32)18(9-5-3-4-6-12-23(30)31)19(26(27)33)15-13-17(29)14-16-22-24(28)20-10-7-8-11-21(20)34-22/h7-8,10-11,13,15,17-19,26,29,33H,4,6,9,12,14,16H2,1-2H3,(H,30,31)/b15-13-/t17?,18-,19-,26+/m1/s1 |
| InChIKey | VICZEZKKTCERBB-FZDLZLEKSA-N |
| XLogP | 5.26 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.06 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|