C30H36N2O5 — CID 10029124
[1,10-dihydroxy-6-oxo-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-11H-benzo[b][1,4]benzodiazepin-3-yl] acetate (PubChem CID 10029124) has the molecular formula C30H36N2O5 and a molecular weight of 504.63 g/mol. Its IUPAC name is [1,10-dihydroxy-6-oxo-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-11H-benzo[b][1,4]benzodiazepin-3-yl] acetate.
| Compound Name | [1,10-dihydroxy-6-oxo-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-11H-benzo[b][1,4]benzodiazepin-3-yl] acetate |
|---|---|
| PubChem CID | 10029124 |
| Molecular Formula | C30H36N2O5 |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.26 |
| IUPAC Name | [1,10-dihydroxy-6-oxo-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-11H-benzo[b][1,4]benzodiazepin-3-yl] acetate |
| SMILES | CC(=O)Oc1cc(O)c2c(c1)N(C/C=C(\C)CC/C=C(\C)CCC=C(C)C)C(=O)c1cccc(O)c1N2 |
| InChI | InChI=1S/C30H36N2O5/c1-19(2)9-6-10-20(3)11-7-12-21(4)15-16-32-25-17-23(37-22(5)33)18-27(35)29(25)31-28-24(30(32)36)13-8-14-26(28)34/h8-9,11,13-15,17-18,31,34-35H,6-7,10,12,16H2,1-5H3/b20-11+,21-15+ |
| InChIKey | YYZYHBIBBRDGQA-JAGDBARYSA-N |
| XLogP | 7.15 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|