C31H26N2O3S — CID 10029218
N-[[3-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]phenyl]methyl]-N-methyl-4-phenylbenzamide (PubChem CID 10029218) has the molecular formula C31H26N2O3S and a molecular weight of 506.63 g/mol. Its IUPAC name is N-[[3-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]phenyl]methyl]-N-methyl-4-phenylbenzamide.
| Compound Name | N-[[3-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]phenyl]methyl]-N-methyl-4-phenylbenzamide |
|---|---|
| PubChem CID | 10029218 |
| Molecular Formula | C31H26N2O3S |
| Molecular Weight | 506.63 g/mol |
| Exact Mass | 506.17 |
| IUPAC Name | N-[[3-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]phenyl]methyl]-N-methyl-4-phenylbenzamide |
| SMILES | CN(Cc1cccc(-c2ccc(CC3SC(=O)NC3=O)cc2)c1)C(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C31H26N2O3S/c1-33(30(35)26-16-14-24(15-17-26)23-7-3-2-4-8-23)20-22-6-5-9-27(18-22)25-12-10-21(11-13-25)19-28-29(34)32-31(36)37-28/h2-18,28H,19-20H2,1H3,(H,32,34,36) |
| InChIKey | WWJHMAOOOQTJHB-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.63 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|