About 2-[3,3-bis(diethoxyphosphoryl)propyl]-5-hydroxy-3-methyl-6-phenylpyrimidin-4-one
2-[3,3-bis(diethoxyphosphoryl)propyl]-5-hydroxy-3-methyl-6-phenylpyrimidin-4-one (PubChem CID 10029523) has the molecular formula C22H34N2O8P2
and a molecular weight of 516.47 g/mol. Its IUPAC name is 2-[3,3-bis(diethoxyphosphoryl)propyl]-5-hydroxy-3-methyl-6-phenylpyrimidin-4-one.
Molecular Properties
| Compound Name | 2-[3,3-bis(diethoxyphosphoryl)propyl]-5-hydroxy-3-methyl-6-phenylpyrimidin-4-one |
| PubChem CID | 10029523 |
| Molecular Formula | C22H34N2O8P2 |
| Molecular Weight | 516.47 g/mol |
| Exact Mass | 516.18 |
| IUPAC Name | 2-[3,3-bis(diethoxyphosphoryl)propyl]-5-hydroxy-3-methyl-6-phenylpyrimidin-4-one |
| SMILES | CCOP(=O)(OCC)C(CCc1nc(-c2ccccc2)c(O)c(=O)n1C)P(=O)(OCC)OCC |
| InChI | InChI=1S/C22H34N2O8P2/c1-6-29-33(27,30-7-2)19(34(28,31-8-3)32-9-4)16-15-18-23-20(17-13-11-10-12-14-17)21(25)22(26)24(18)5/h10-14,19,25H,6-9,15-16H2,1-5H3 |
| InChIKey | KNBVQPKJDSRBTP-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 126.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 516.47 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-[3,3-bis(diethoxyphosphoryl)propyl]-5-hydroxy-3-methyl-6-phenylpyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,3-bis(diethoxyphosphoryl)propyl]-5-hydroxy-3-methyl-6-phenylpyrimidin-4-one?
The IUPAC name of 2-[3,3-bis(diethoxyphosphoryl)propyl]-5-hydroxy-3-methyl-6-phenylpyrimidin-4-one (CID 10029523) is 2-[3,3-bis(diethoxyphosphoryl)propyl]-5-hydroxy-3-methyl-6-phenylpyrimidin-4-one.
What is the SMILES notation for 2-[3,3-bis(diethoxyphosphoryl)propyl]-5-hydroxy-3-methyl-6-phenylpyrimidin-4-one?
The canonical SMILES for 2-[3,3-bis(diethoxyphosphoryl)propyl]-5-hydroxy-3-methyl-6-phenylpyrimidin-4-one is CCOP(=O)(OCC)C(CCc1nc(-c2ccccc2)c(O)c(=O)n1C)P(=O)(OCC)OCC.
What is the InChIKey of 2-[3,3-bis(diethoxyphosphoryl)propyl]-5-hydroxy-3-methyl-6-phenylpyrimidin-4-one?
The InChIKey is KNBVQPKJDSRBTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H34N2O8P2/c1-6-29-33(27,30-7-2)19(34(28,31-8-3)32-9-4)16-15-18-23-20(17-13-11-10-12-14-17)21(25)22(26)24(18)5/h10-14,19,25H,6-9,15-16H2,1-5H3.
What are the key properties of 2-[3,3-bis(diethoxyphosphoryl)propyl]-5-hydroxy-3-methyl-6-phenylpyrimidin-4-one?
2-[3,3-bis(diethoxyphosphoryl)propyl]-5-hydroxy-3-methyl-6-phenylpyrimidin-4-one has a molecular weight of 516.47 g/mol, XLogP of 4.94, 14 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,3-bis(diethoxyphosphoryl)propyl]-5-hydroxy-3-methyl-6-phenylpyrimidin-4-one is sourced from PubChem (CID 10029523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).