C29H40O8 — CID 10029533
[(E)-2-[(1S,2S,7S)-5-(acetyloxymethyl)-2-(3-acetyloxy-4-methylpent-4-enyl)-2-methyl-6-oxo-7-(2-oxopropyl)cyclohept-4-en-1-yl]ethenyl] 3-methylbut-2-enoate (PubChem CID 10029533) has the molecular formula C29H40O8 and a molecular weight of 516.63 g/mol. Its IUPAC name is [(E)-2-[(1S,2S,7S)-5-(acetyloxymethyl)-2-(3-acetyloxy-4-methylpent-4-enyl)-2-methyl-6-oxo-7-(2-oxopropyl)cyclohept-4-en-1-yl]ethenyl] 3-methylbut-2-enoate.
| Compound Name | [(E)-2-[(1S,2S,7S)-5-(acetyloxymethyl)-2-(3-acetyloxy-4-methylpent-4-enyl)-2-methyl-6-oxo-7-(2-oxopropyl)cyclohept-4-en-1-yl]ethenyl] 3-methylbut-2-enoate |
|---|---|
| PubChem CID | 10029533 |
| Molecular Formula | C29H40O8 |
| Molecular Weight | 516.63 g/mol |
| Exact Mass | 516.27 |
| IUPAC Name | [(E)-2-[(1S,2S,7S)-5-(acetyloxymethyl)-2-(3-acetyloxy-4-methylpent-4-enyl)-2-methyl-6-oxo-7-(2-oxopropyl)cyclohept-4-en-1-yl]ethenyl] 3-methylbut-2-enoate |
| SMILES | C=C(C)C(CC[C@@]1(C)CC=C(COC(C)=O)C(=O)[C@@H](CC(C)=O)[C@@H]1/C=C/OC(=O)C=C(C)C)OC(C)=O |
| InChI | InChI=1S/C29H40O8/c1-18(2)15-27(33)35-14-11-25-24(16-20(5)30)28(34)23(17-36-21(6)31)9-12-29(25,8)13-10-26(19(3)4)37-22(7)32/h9,11,14-15,24-26H,3,10,12-13,16-17H2,1-2,4-8H3/b14-11+/t24-,25-,26?,29+/m0/s1 |
| InChIKey | RVXIDAKARLZMMV-ATIRDTRSSA-N |
| XLogP | 4.98 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.63 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|