C20H24F2IN3O3 — CID 10029612
[1-(3-carboxy-1-cyclopropyl-6,8-difluoro-4-oxoquinolin-7-yl)-3-methylazetidin-3-yl]-trimethylazanium iodide (PubChem CID 10029612) has the molecular formula C20H24F2IN3O3 and a molecular weight of 519.33 g/mol. Its IUPAC name is [1-(3-carboxy-1-cyclopropyl-6,8-difluoro-4-oxoquinolin-7-yl)-3-methylazetidin-3-yl]-trimethylazanium iodide.
| Compound Name | [1-(3-carboxy-1-cyclopropyl-6,8-difluoro-4-oxoquinolin-7-yl)-3-methylazetidin-3-yl]-trimethylazanium iodide |
|---|---|
| PubChem CID | 10029612 |
| Molecular Formula | C20H24F2IN3O3 |
| Molecular Weight | 519.33 g/mol |
| Exact Mass | 519.08 |
| IUPAC Name | [1-(3-carboxy-1-cyclopropyl-6,8-difluoro-4-oxoquinolin-7-yl)-3-methylazetidin-3-yl]-trimethylazanium iodide |
| SMILES | CC1([N+](C)(C)C)CN(c2c(F)cc3c(=O)c(C(=O)O)cn(C4CC4)c3c2F)C1.[I-] |
| InChI | InChI=1S/C20H23F2N3O3.HI/c1-20(25(2,3)4)9-23(10-20)17-14(21)7-12-16(15(17)22)24(11-5-6-11)8-13(18(12)26)19(27)28;/h7-8,11H,5-6,9-10H2,1-4H3;1H |
| InChIKey | ITQCJBIWWAAGPK-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.33 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|