C28H44F2N4OS — CID 10029732
3-(2,4-difluorophenyl)-1-[5-[(4,5-dipropyl-1H-imidazol-2-yl)sulfanyl]pentyl]-1-heptylurea (PubChem CID 10029732) has the molecular formula C28H44F2N4OS and a molecular weight of 522.75 g/mol. Its IUPAC name is 3-(2,4-difluorophenyl)-1-[5-[(4,5-dipropyl-1H-imidazol-2-yl)sulfanyl]pentyl]-1-heptylurea.
| Compound Name | 3-(2,4-difluorophenyl)-1-[5-[(4,5-dipropyl-1H-imidazol-2-yl)sulfanyl]pentyl]-1-heptylurea |
|---|---|
| PubChem CID | 10029732 |
| Molecular Formula | C28H44F2N4OS |
| Molecular Weight | 522.75 g/mol |
| Exact Mass | 522.32 |
| IUPAC Name | 3-(2,4-difluorophenyl)-1-[5-[(4,5-dipropyl-1H-imidazol-2-yl)sulfanyl]pentyl]-1-heptylurea |
| SMILES | CCCCCCCN(CCCCCSc1nc(CCC)c(CCC)[nH]1)C(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C28H44F2N4OS/c1-4-7-8-9-11-18-34(28(35)33-24-17-16-22(29)21-23(24)30)19-12-10-13-20-36-27-31-25(14-5-2)26(32-27)15-6-3/h16-17,21H,4-15,18-20H2,1-3H3,(H,31,32)(H,33,35) |
| InChIKey | OYQUHMPSZCSAKF-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.75 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|