C33H37NO3S — CID 10029866
4-[(E)-3-[4-[[4-(dimethylamino)phenyl]methylsulfanyl]-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]-3-oxoprop-1-enyl]benzoic acid (PubChem CID 10029866) has the molecular formula C33H37NO3S and a molecular weight of 527.73 g/mol. Its IUPAC name is 4-[(E)-3-[4-[[4-(dimethylamino)phenyl]methylsulfanyl]-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]-3-oxoprop-1-enyl]benzoic acid.
| Compound Name | 4-[(E)-3-[4-[[4-(dimethylamino)phenyl]methylsulfanyl]-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]-3-oxoprop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 10029866 |
| Molecular Formula | C33H37NO3S |
| Molecular Weight | 527.73 g/mol |
| Exact Mass | 527.25 |
| IUPAC Name | 4-[(E)-3-[4-[[4-(dimethylamino)phenyl]methylsulfanyl]-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]-3-oxoprop-1-enyl]benzoic acid |
| SMILES | CN(C)c1ccc(CSc2cc(C(=O)/C=C/c3ccc(C(=O)O)cc3)cc3c2C(C)(C)CCC3(C)C)cc1 |
| InChI | InChI=1S/C33H37NO3S/c1-32(2)17-18-33(3,4)30-27(32)19-25(28(35)16-11-22-7-12-24(13-8-22)31(36)37)20-29(30)38-21-23-9-14-26(15-10-23)34(5)6/h7-16,19-20H,17-18,21H2,1-6H3,(H,36,37)/b16-11+ |
| InChIKey | IEJROWASMHOVIX-LFIBNONCSA-N |
| XLogP | 7.99 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.73 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|