C26H27ClN2O6S — CID 10029962
N-[4-chloro-3-[(3R)-1-methylpyrrolidin-3-yl]oxyphenyl]-2-(3-formylphenyl)-4,5-dimethoxybenzenesulfonamide (PubChem CID 10029962) has the molecular formula C26H27ClN2O6S and a molecular weight of 531.03 g/mol. Its IUPAC name is N-[4-chloro-3-[(3R)-1-methylpyrrolidin-3-yl]oxyphenyl]-2-(3-formylphenyl)-4,5-dimethoxybenzenesulfonamide.
| Compound Name | N-[4-chloro-3-[(3R)-1-methylpyrrolidin-3-yl]oxyphenyl]-2-(3-formylphenyl)-4,5-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 10029962 |
| Molecular Formula | C26H27ClN2O6S |
| Molecular Weight | 531.03 g/mol |
| Exact Mass | 530.13 |
| IUPAC Name | N-[4-chloro-3-[(3R)-1-methylpyrrolidin-3-yl]oxyphenyl]-2-(3-formylphenyl)-4,5-dimethoxybenzenesulfonamide |
| SMILES | COc1cc(-c2cccc(C=O)c2)c(S(=O)(=O)Nc2ccc(Cl)c(O[C@@H]3CCN(C)C3)c2)cc1OC |
| InChI | InChI=1S/C26H27ClN2O6S/c1-29-10-9-20(15-29)35-23-12-19(7-8-22(23)27)28-36(31,32)26-14-25(34-3)24(33-2)13-21(26)18-6-4-5-17(11-18)16-30/h4-8,11-14,16,20,28H,9-10,15H2,1-3H3/t20-/m1/s1 |
| InChIKey | IHDMLMJAWXVVJV-HXUWFJFHSA-N |
| XLogP | 4.72 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.03 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|