C27H32N6O4S — CID 10030110
4-[[5-[(Z)-[3-[(2-amino-1,3-thiazol-4-yl)methyl]-1-butyl-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-butylimidazol-1-yl]methyl]benzoic acid (PubChem CID 10030110) has the molecular formula C27H32N6O4S and a molecular weight of 536.66 g/mol. Its IUPAC name is 4-[[5-[(Z)-[3-[(2-amino-1,3-thiazol-4-yl)methyl]-1-butyl-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-butylimidazol-1-yl]methyl]benzoic acid.
| Compound Name | 4-[[5-[(Z)-[3-[(2-amino-1,3-thiazol-4-yl)methyl]-1-butyl-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-butylimidazol-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 10030110 |
| Molecular Formula | C27H32N6O4S |
| Molecular Weight | 536.66 g/mol |
| Exact Mass | 536.22 |
| IUPAC Name | 4-[[5-[(Z)-[3-[(2-amino-1,3-thiazol-4-yl)methyl]-1-butyl-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-butylimidazol-1-yl]methyl]benzoic acid |
| SMILES | CCCCc1ncc(/C=C2/C(=O)N(CCCC)C(=O)N2Cc2csc(N)n2)n1Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C27H32N6O4S/c1-3-5-7-23-29-14-21(32(23)15-18-8-10-19(11-9-18)25(35)36)13-22-24(34)31(12-6-4-2)27(37)33(22)16-20-17-38-26(28)30-20/h8-11,13-14,17H,3-7,12,15-16H2,1-2H3,(H2,28,30)(H,35,36)/b22-13- |
| InChIKey | XLDPYCCVJVFDNB-XKZIYDEJSA-N |
| XLogP | 4.62 |
| TPSA | 134.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.66 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|