C25H16INO5 — CID 10030133
7-(4-hydroxy-3-iodophenyl)-3,8-bis(4-hydroxyphenyl)pyrrolo[2,1-c][1,4]oxazin-1-one (PubChem CID 10030133) has the molecular formula C25H16INO5 and a molecular weight of 537.31 g/mol. Its IUPAC name is 7-(4-hydroxy-3-iodophenyl)-3,8-bis(4-hydroxyphenyl)pyrrolo[2,1-c][1,4]oxazin-1-one.
| Compound Name | 7-(4-hydroxy-3-iodophenyl)-3,8-bis(4-hydroxyphenyl)pyrrolo[2,1-c][1,4]oxazin-1-one |
|---|---|
| PubChem CID | 10030133 |
| Molecular Formula | C25H16INO5 |
| Molecular Weight | 537.31 g/mol |
| Exact Mass | 537.01 |
| IUPAC Name | 7-(4-hydroxy-3-iodophenyl)-3,8-bis(4-hydroxyphenyl)pyrrolo[2,1-c][1,4]oxazin-1-one |
| SMILES | O=c1oc(-c2ccc(O)cc2)cn2cc(-c3ccc(O)c(I)c3)c(-c3ccc(O)cc3)c12 |
| InChI | InChI=1S/C25H16INO5/c26-20-11-16(5-10-21(20)30)19-12-27-13-22(14-1-6-17(28)7-2-14)32-25(31)24(27)23(19)15-3-8-18(29)9-4-15/h1-13,28-30H |
| InChIKey | VCJNERXEMOVASY-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 95.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.31 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|