C33H48O6 — CID 10030210
(7E,15E,19E)-4,6,12,18-tetrahydroxy-21-methyl-10-methylidene-22-[(1E,3Z,5Z)-3-methylnona-1,3,5,8-tetraenyl]-1-oxacyclodocosa-7,15,19-trien-2-one (PubChem CID 10030210) has the molecular formula C33H48O6 and a molecular weight of 540.74 g/mol. Its IUPAC name is (7E,15E,19E)-4,6,12,18-tetrahydroxy-21-methyl-10-methylidene-22-[(1E,3Z,5Z)-3-methylnona-1,3,5,8-tetraenyl]-1-oxacyclodocosa-7,15,19-trien-2-one.
| Compound Name | (7E,15E,19E)-4,6,12,18-tetrahydroxy-21-methyl-10-methylidene-22-[(1E,3Z,5Z)-3-methylnona-1,3,5,8-tetraenyl]-1-oxacyclodocosa-7,15,19-trien-2-one |
|---|---|
| PubChem CID | 10030210 |
| Molecular Formula | C33H48O6 |
| Molecular Weight | 540.74 g/mol |
| Exact Mass | 540.35 |
| IUPAC Name | (7E,15E,19E)-4,6,12,18-tetrahydroxy-21-methyl-10-methylidene-22-[(1E,3Z,5Z)-3-methylnona-1,3,5,8-tetraenyl]-1-oxacyclodocosa-7,15,19-trien-2-one |
| SMILES | C=CC/C=C\C=C(C)/C=C/C1OC(=O)CC(O)CC(O)/C=C/CC(=C)CC(O)CC/C=C/CC(O)/C=C/C1C |
| InChI | InChI=1S/C33H48O6/c1-5-6-7-9-13-25(2)18-21-32-27(4)19-20-28(34)15-10-8-11-16-29(35)22-26(3)14-12-17-30(36)23-31(37)24-33(38)39-32/h5,7-10,12-13,17-21,27-32,34-37H,1,3,6,11,14-16,22-24H2,2,4H3/b9-7-,10-8+,17-12+,20-19+,21-18+,25-13- |
| InChIKey | GXWAJHCYRDABLE-SMHIWBEXSA-N |
| XLogP | 5.58 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.74 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|