C31H34F2N4OS — CID 10030425
3-(2,4-difluorophenyl)-1-[2-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]ethyl]-1-heptylurea (PubChem CID 10030425) has the molecular formula C31H34F2N4OS and a molecular weight of 548.70 g/mol. Its IUPAC name is 3-(2,4-difluorophenyl)-1-[2-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]ethyl]-1-heptylurea.
| Compound Name | 3-(2,4-difluorophenyl)-1-[2-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]ethyl]-1-heptylurea |
|---|---|
| PubChem CID | 10030425 |
| Molecular Formula | C31H34F2N4OS |
| Molecular Weight | 548.70 g/mol |
| Exact Mass | 548.24 |
| IUPAC Name | 3-(2,4-difluorophenyl)-1-[2-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]ethyl]-1-heptylurea |
| SMILES | CCCCCCCN(CCSc1nc(-c2ccccc2)c(-c2ccccc2)[nH]1)C(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C31H34F2N4OS/c1-2-3-4-5-12-19-37(31(38)34-27-18-17-25(32)22-26(27)33)20-21-39-30-35-28(23-13-8-6-9-14-23)29(36-30)24-15-10-7-11-16-24/h6-11,13-18,22H,2-5,12,19-21H2,1H3,(H,34,38)(H,35,36) |
| InChIKey | ANTWTEZWBQIAKQ-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.70 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|