C29H51NO5Si2 — CID 10030447
(5R,7S)-4-(2-ethoxy-2-trimethylsilyloxyethenylidene)-7-(furan-3-yl)-8,8-dimethyl-1-pyrrolidin-1-yl-5-trimethylsilyloxynonan-1-one (PubChem CID 10030447) has the molecular formula C29H51NO5Si2 and a molecular weight of 549.90 g/mol. Its IUPAC name is (5R,7S)-4-(2-ethoxy-2-trimethylsilyloxyethenylidene)-7-(furan-3-yl)-8,8-dimethyl-1-pyrrolidin-1-yl-5-trimethylsilyloxynonan-1-one.
| Compound Name | (5R,7S)-4-(2-ethoxy-2-trimethylsilyloxyethenylidene)-7-(furan-3-yl)-8,8-dimethyl-1-pyrrolidin-1-yl-5-trimethylsilyloxynonan-1-one |
|---|---|
| PubChem CID | 10030447 |
| Molecular Formula | C29H51NO5Si2 |
| Molecular Weight | 549.90 g/mol |
| Exact Mass | 549.33 |
| IUPAC Name | (5R,7S)-4-(2-ethoxy-2-trimethylsilyloxyethenylidene)-7-(furan-3-yl)-8,8-dimethyl-1-pyrrolidin-1-yl-5-trimethylsilyloxynonan-1-one |
| SMILES | CCOC(=C=C(CCC(=O)N1CCCC1)[C@@H](C[C@H](c1ccoc1)C(C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C29H51NO5Si2/c1-11-33-28(35-37(8,9)10)20-23(14-15-27(31)30-17-12-13-18-30)26(34-36(5,6)7)21-25(29(2,3)4)24-16-19-32-22-24/h16,19,22,25-26H,11-15,17-18,21H2,1-10H3/t20?,25-,26-/m1/s1 |
| InChIKey | JVUSTEVRFXGULL-TWAOCZIPSA-N |
| XLogP | 7.68 |
| TPSA | 61.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.90 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|