C31H46N4O3S — CID 10030575
1-(1-azabicyclo[2.2.2]octan-3-yl)-3-[(1S,2S,4R)-7,7-dimethyl-1-(spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylsulfonylmethyl)-2-bicyclo[2.2.1]heptanyl]urea (PubChem CID 10030575) has the molecular formula C31H46N4O3S and a molecular weight of 554.80 g/mol. Its IUPAC name is 1-(1-azabicyclo[2.2.2]octan-3-yl)-3-[(1S,2S,4R)-7,7-dimethyl-1-(spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylsulfonylmethyl)-2-bicyclo[2.2.1]heptanyl]urea.
| Compound Name | 1-(1-azabicyclo[2.2.2]octan-3-yl)-3-[(1S,2S,4R)-7,7-dimethyl-1-(spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylsulfonylmethyl)-2-bicyclo[2.2.1]heptanyl]urea |
|---|---|
| PubChem CID | 10030575 |
| Molecular Formula | C31H46N4O3S |
| Molecular Weight | 554.80 g/mol |
| Exact Mass | 554.33 |
| IUPAC Name | 1-(1-azabicyclo[2.2.2]octan-3-yl)-3-[(1S,2S,4R)-7,7-dimethyl-1-(spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylsulfonylmethyl)-2-bicyclo[2.2.1]heptanyl]urea |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(CS(=O)(=O)N1CCC3(CCc4ccccc43)CC1)[C@@H](NC(=O)NC1CN3CCC1CC3)C2 |
| InChI | InChI=1S/C31H46N4O3S/c1-29(2)24-8-12-31(29,27(19-24)33-28(36)32-26-20-34-15-9-23(26)10-16-34)21-39(37,38)35-17-13-30(14-18-35)11-7-22-5-3-4-6-25(22)30/h3-6,23-24,26-27H,7-21H2,1-2H3,(H2,32,33,36)/t24-,26?,27+,31-/m1/s1 |
| InChIKey | RRGFYPFFXNYKFX-MBCNDWFISA-N |
| XLogP | 3.88 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.80 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |