C30H54O7Si — CID 10030576
(3R,4S)-3-[(1S,3aR,4S,6S,8aR)-4-[tert-butyl(dimethyl)silyl]oxy-1-(2-methoxyethoxymethoxy)-1,2,3,3a,4,5,6,8a-octahydroazulen-6-yl]-6-(1,3-dioxolan-2-yl)-4-methylhexanal (PubChem CID 10030576) has the molecular formula C30H54O7Si and a molecular weight of 554.84 g/mol. Its IUPAC name is (3R,4S)-3-[(1S,3aR,4S,6S,8aR)-4-[tert-butyl(dimethyl)silyl]oxy-1-(2-methoxyethoxymethoxy)-1,2,3,3a,4,5,6,8a-octahydroazulen-6-yl]-6-(1,3-dioxolan-2-yl)-4-methylhexanal.
| Compound Name | (3R,4S)-3-[(1S,3aR,4S,6S,8aR)-4-[tert-butyl(dimethyl)silyl]oxy-1-(2-methoxyethoxymethoxy)-1,2,3,3a,4,5,6,8a-octahydroazulen-6-yl]-6-(1,3-dioxolan-2-yl)-4-methylhexanal |
|---|---|
| PubChem CID | 10030576 |
| Molecular Formula | C30H54O7Si |
| Molecular Weight | 554.84 g/mol |
| Exact Mass | 554.36 |
| IUPAC Name | (3R,4S)-3-[(1S,3aR,4S,6S,8aR)-4-[tert-butyl(dimethyl)silyl]oxy-1-(2-methoxyethoxymethoxy)-1,2,3,3a,4,5,6,8a-octahydroazulen-6-yl]-6-(1,3-dioxolan-2-yl)-4-methylhexanal |
| SMILES | COCCOCO[C@H]1CC[C@@H]2[C@H]1C=C[C@@H]([C@H](CC=O)[C@@H](C)CCC1OCCO1)C[C@@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H54O7Si/c1-22(8-13-29-34-18-19-35-29)24(14-15-31)23-9-10-25-26(11-12-27(25)36-21-33-17-16-32-5)28(20-23)37-38(6,7)30(2,3)4/h9-10,15,22-29H,8,11-14,16-21H2,1-7H3/t22-,23+,24+,25+,26+,27-,28-/m0/s1 |
| InChIKey | QQOAKWPOZIBIKL-RMZQZVDHSA-N |
| XLogP | 5.98 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.84 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|