C34H49N3O4 — CID 10030777
methyl N-butyl-N-[[3-[4-[[(2S,5S)-1,5-dimethyl-4-octyl-3,6-dioxopiperazin-2-yl]methyl]phenyl]phenyl]methyl]carbamate (PubChem CID 10030777) has the molecular formula C34H49N3O4 and a molecular weight of 563.78 g/mol. Its IUPAC name is methyl N-butyl-N-[[3-[4-[[(2S,5S)-1,5-dimethyl-4-octyl-3,6-dioxopiperazin-2-yl]methyl]phenyl]phenyl]methyl]carbamate.
| Compound Name | methyl N-butyl-N-[[3-[4-[[(2S,5S)-1,5-dimethyl-4-octyl-3,6-dioxopiperazin-2-yl]methyl]phenyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 10030777 |
| Molecular Formula | C34H49N3O4 |
| Molecular Weight | 563.78 g/mol |
| Exact Mass | 563.37 |
| IUPAC Name | methyl N-butyl-N-[[3-[4-[[(2S,5S)-1,5-dimethyl-4-octyl-3,6-dioxopiperazin-2-yl]methyl]phenyl]phenyl]methyl]carbamate |
| SMILES | CCCCCCCCN1C(=O)[C@H](Cc2ccc(-c3cccc(CN(CCCC)C(=O)OC)c3)cc2)N(C)C(=O)[C@@H]1C |
| InChI | InChI=1S/C34H49N3O4/c1-6-8-10-11-12-13-22-37-26(3)32(38)35(4)31(33(37)39)24-27-17-19-29(20-18-27)30-16-14-15-28(23-30)25-36(21-9-7-2)34(40)41-5/h14-20,23,26,31H,6-13,21-22,24-25H2,1-5H3/t26-,31-/m0/s1 |
| InChIKey | IZDKWWJWMFHPAE-HVNZXBJASA-N |
| XLogP | 6.68 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.78 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|