C34H36N4O4 — CID 10030800
5-amino-N-[4-[4-[(3,4-dimethoxyphenyl)methyl-methylamino]butyl]phenyl]-9-oxo-10H-acridine-4-carboxamide (PubChem CID 10030800) has the molecular formula C34H36N4O4 and a molecular weight of 564.69 g/mol. Its IUPAC name is 5-amino-N-[4-[4-[(3,4-dimethoxyphenyl)methyl-methylamino]butyl]phenyl]-9-oxo-10H-acridine-4-carboxamide.
| Compound Name | 5-amino-N-[4-[4-[(3,4-dimethoxyphenyl)methyl-methylamino]butyl]phenyl]-9-oxo-10H-acridine-4-carboxamide |
|---|---|
| PubChem CID | 10030800 |
| Molecular Formula | C34H36N4O4 |
| Molecular Weight | 564.69 g/mol |
| Exact Mass | 564.27 |
| IUPAC Name | 5-amino-N-[4-[4-[(3,4-dimethoxyphenyl)methyl-methylamino]butyl]phenyl]-9-oxo-10H-acridine-4-carboxamide |
| SMILES | COc1ccc(CN(C)CCCCc2ccc(NC(=O)c3cccc4c(=O)c5cccc(N)c5[nH]c34)cc2)cc1OC |
| InChI | InChI=1S/C34H36N4O4/c1-38(21-23-15-18-29(41-2)30(20-23)42-3)19-5-4-8-22-13-16-24(17-14-22)36-34(40)27-11-6-9-25-31(27)37-32-26(33(25)39)10-7-12-28(32)35/h6-7,9-18,20H,4-5,8,19,21,35H2,1-3H3,(H,36,40)(H,37,39) |
| InChIKey | JSNGMAOUHVFCBO-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 109.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.69 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|