C28H24F3N3O5S — CID 10030944
[11-[4-(1-methylindol-3-yl)-2,5-dioxopyrrol-3-yl]-7,8,9,10-tetrahydro-6H-azepino[1,2-a]indol-9-yl]methyl trifluoromethanesulfonate (PubChem CID 10030944) has the molecular formula C28H24F3N3O5S and a molecular weight of 571.58 g/mol. Its IUPAC name is [11-[4-(1-methylindol-3-yl)-2,5-dioxopyrrol-3-yl]-7,8,9,10-tetrahydro-6H-azepino[1,2-a]indol-9-yl]methyl trifluoromethanesulfonate.
| Compound Name | [11-[4-(1-methylindol-3-yl)-2,5-dioxopyrrol-3-yl]-7,8,9,10-tetrahydro-6H-azepino[1,2-a]indol-9-yl]methyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10030944 |
| Molecular Formula | C28H24F3N3O5S |
| Molecular Weight | 571.58 g/mol |
| Exact Mass | 571.14 |
| IUPAC Name | [11-[4-(1-methylindol-3-yl)-2,5-dioxopyrrol-3-yl]-7,8,9,10-tetrahydro-6H-azepino[1,2-a]indol-9-yl]methyl trifluoromethanesulfonate |
| SMILES | Cn1cc(C2=C(c3c4n(c5ccccc35)CCCC(COS(=O)(=O)C(F)(F)F)C4)C(=O)NC2=O)c2ccccc21 |
| InChI | InChI=1S/C28H24F3N3O5S/c1-33-14-19(17-8-2-4-10-20(17)33)24-25(27(36)32-26(24)35)23-18-9-3-5-11-21(18)34-12-6-7-16(13-22(23)34)15-39-40(37,38)28(29,30)31/h2-5,8-11,14,16H,6-7,12-13,15H2,1H3,(H,32,35,36) |
| InChIKey | ZUCFKUVCKXPHLK-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 99.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.58 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|