C17H27HgO2 — CID 10031071
[(Z)-(2-methoxy-2,4-dimethyl-3-octyl-5-oxocyclopent-3-en-1-ylidene)methyl]mercury (PubChem CID 10031071) has the molecular formula C17H27HgO2 and a molecular weight of 463.99 g/mol. Its IUPAC name is [(Z)-(2-methoxy-2,4-dimethyl-3-octyl-5-oxocyclopent-3-en-1-ylidene)methyl]mercury.
| Compound Name | [(Z)-(2-methoxy-2,4-dimethyl-3-octyl-5-oxocyclopent-3-en-1-ylidene)methyl]mercury |
|---|---|
| PubChem CID | 10031071 |
| Molecular Formula | C17H27HgO2 |
| Molecular Weight | 463.99 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | [(Z)-(2-methoxy-2,4-dimethyl-3-octyl-5-oxocyclopent-3-en-1-ylidene)methyl]mercury |
| SMILES | CCCCCCCCC1=C(C)C(=O)/C(=C\[Hg])C1(C)OC |
| InChI | InChI=1S/C17H27O2.Hg/c1-6-7-8-9-10-11-12-15-13(2)16(18)14(3)17(15,4)19-5;/h3H,6-12H2,1-2,4-5H3; |
| InChIKey | HHTKFHIEUSMVKL-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.99 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|