C31H53N2O6P — CID 10031152
[(2S)-1-[[(2S,3S,5R)-6-(butylamino)-1-cyclohexyl-3-hydroxy-5-methyl-6-oxohexan-2-yl]amino]-1-oxopentan-2-yl]oxy-(3-phenylpropyl)phosphinic acid (PubChem CID 10031152) has the molecular formula C31H53N2O6P and a molecular weight of 580.75 g/mol. Its IUPAC name is [(2S)-1-[[(2S,3S,5R)-6-(butylamino)-1-cyclohexyl-3-hydroxy-5-methyl-6-oxohexan-2-yl]amino]-1-oxopentan-2-yl]oxy-(3-phenylpropyl)phosphinic acid.
| Compound Name | [(2S)-1-[[(2S,3S,5R)-6-(butylamino)-1-cyclohexyl-3-hydroxy-5-methyl-6-oxohexan-2-yl]amino]-1-oxopentan-2-yl]oxy-(3-phenylpropyl)phosphinic acid |
|---|---|
| PubChem CID | 10031152 |
| Molecular Formula | C31H53N2O6P |
| Molecular Weight | 580.75 g/mol |
| Exact Mass | 580.36 |
| IUPAC Name | [(2S)-1-[[(2S,3S,5R)-6-(butylamino)-1-cyclohexyl-3-hydroxy-5-methyl-6-oxohexan-2-yl]amino]-1-oxopentan-2-yl]oxy-(3-phenylpropyl)phosphinic acid |
| SMILES | CCCCNC(=O)[C@H](C)C[C@H](O)[C@H](CC1CCCCC1)NC(=O)[C@H](CCC)OP(=O)(O)CCCc1ccccc1 |
| InChI | InChI=1S/C31H53N2O6P/c1-4-6-20-32-30(35)24(3)22-28(34)27(23-26-17-11-8-12-18-26)33-31(36)29(14-5-2)39-40(37,38)21-13-19-25-15-9-7-10-16-25/h7,9-10,15-16,24,26-29,34H,4-6,8,11-14,17-23H2,1-3H3,(H,32,35)(H,33,36)(H,37,38)/t24-,27+,28+,29+/m1/s1 |
| InChIKey | NEIVDWDBIVCGCM-KHUDPXOFSA-N |
| XLogP | 5.75 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.75 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|