C30H23F6N5O — CID 10031196
2-(3-phenylmethoxypropyl)-7-[3-(trifluoromethyl)-2-pyridinyl]-N-[6-(trifluoromethyl)-3-pyridinyl]quinazolin-4-amine (PubChem CID 10031196) has the molecular formula C30H23F6N5O and a molecular weight of 583.54 g/mol. Its IUPAC name is 2-(3-phenylmethoxypropyl)-7-[3-(trifluoromethyl)-2-pyridinyl]-N-[6-(trifluoromethyl)-3-pyridinyl]quinazolin-4-amine.
| Compound Name | 2-(3-phenylmethoxypropyl)-7-[3-(trifluoromethyl)-2-pyridinyl]-N-[6-(trifluoromethyl)-3-pyridinyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 10031196 |
| Molecular Formula | C30H23F6N5O |
| Molecular Weight | 583.54 g/mol |
| Exact Mass | 583.18 |
| IUPAC Name | 2-(3-phenylmethoxypropyl)-7-[3-(trifluoromethyl)-2-pyridinyl]-N-[6-(trifluoromethyl)-3-pyridinyl]quinazolin-4-amine |
| SMILES | FC(F)(F)c1ccc(Nc2nc(CCCOCc3ccccc3)nc3cc(-c4ncccc4C(F)(F)F)ccc23)cn1 |
| InChI | InChI=1S/C30H23F6N5O/c31-29(32,33)23-8-4-14-37-27(23)20-10-12-22-24(16-20)40-26(9-5-15-42-18-19-6-2-1-3-7-19)41-28(22)39-21-11-13-25(38-17-21)30(34,35)36/h1-4,6-8,10-14,16-17H,5,9,15,18H2,(H,39,40,41) |
| InChIKey | KUYUOCDIYHZIHA-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 72.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.54 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|