C27H28F6N4O4 — CID 10031250
[3,5-bis(trifluoromethyl)phenyl]methyl (3R,6S,9aS)-6-(aminomethyl)-8-benzyl-3-ethyl-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate (PubChem CID 10031250) has the molecular formula C27H28F6N4O4 and a molecular weight of 586.53 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl]methyl (3R,6S,9aS)-6-(aminomethyl)-8-benzyl-3-ethyl-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl]methyl (3R,6S,9aS)-6-(aminomethyl)-8-benzyl-3-ethyl-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate |
|---|---|
| PubChem CID | 10031250 |
| Molecular Formula | C27H28F6N4O4 |
| Molecular Weight | 586.53 g/mol |
| Exact Mass | 586.20 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]methyl (3R,6S,9aS)-6-(aminomethyl)-8-benzyl-3-ethyl-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate |
| SMILES | CC[C@@H]1CN(C(=O)OCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)[C@H]2CN(Cc3ccccc3)C(=O)[C@H](CN)N2C1=O |
| InChI | InChI=1S/C27H28F6N4O4/c1-2-18-13-36(25(40)41-15-17-8-19(26(28,29)30)10-20(9-17)27(31,32)33)22-14-35(12-16-6-4-3-5-7-16)24(39)21(11-34)37(22)23(18)38/h3-10,18,21-22H,2,11-15,34H2,1H3/t18-,21+,22-/m1/s1 |
| InChIKey | CZHOGSKIUVPSKZ-BVYCBKJFSA-N |
| XLogP | 4.23 |
| TPSA | 96.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.53 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |