C31H49N3O8 — CID 10031360
[(3aS,5S,6R,6aS)-3a-(decoxymethyl)-2,2-dimethyl-5-(piperidin-1-ylmethyl)-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-6-yl] N-(4-nitrophenyl)carbamate (PubChem CID 10031360) has the molecular formula C31H49N3O8 and a molecular weight of 591.75 g/mol. Its IUPAC name is [(3aS,5S,6R,6aS)-3a-(decoxymethyl)-2,2-dimethyl-5-(piperidin-1-ylmethyl)-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-6-yl] N-(4-nitrophenyl)carbamate.
| Compound Name | [(3aS,5S,6R,6aS)-3a-(decoxymethyl)-2,2-dimethyl-5-(piperidin-1-ylmethyl)-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-6-yl] N-(4-nitrophenyl)carbamate |
|---|---|
| PubChem CID | 10031360 |
| Molecular Formula | C31H49N3O8 |
| Molecular Weight | 591.75 g/mol |
| Exact Mass | 591.35 |
| IUPAC Name | [(3aS,5S,6R,6aS)-3a-(decoxymethyl)-2,2-dimethyl-5-(piperidin-1-ylmethyl)-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-6-yl] N-(4-nitrophenyl)carbamate |
| SMILES | CCCCCCCCCCOC[C@@]12O[C@@H](CN3CCCCC3)[C@@H](OC(=O)Nc3ccc([N+](=O)[O-])cc3)[C@@H]1OC(C)(C)O2 |
| InChI | InChI=1S/C31H49N3O8/c1-4-5-6-7-8-9-10-14-21-38-23-31-28(41-30(2,3)42-31)27(26(40-31)22-33-19-12-11-13-20-33)39-29(35)32-24-15-17-25(18-16-24)34(36)37/h15-18,26-28H,4-14,19-23H2,1-3H3,(H,32,35)/t26-,27+,28-,31-/m0/s1 |
| InChIKey | ZWTQLWJOVWAWEJ-NFAPWKBDSA-N |
| XLogP | 6.40 |
| TPSA | 121.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.75 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|