C29H30N4O3 — CID 10031442
2-methyl-3-[1-[2-(4-nitrophenyl)ethyl]piperidin-4-yl]-5,5-diphenylimidazol-4-one (PubChem CID 10031442) has the molecular formula C29H30N4O3 and a molecular weight of 482.58 g/mol. Its IUPAC name is 2-methyl-3-[1-[2-(4-nitrophenyl)ethyl]piperidin-4-yl]-5,5-diphenylimidazol-4-one.
| Compound Name | 2-methyl-3-[1-[2-(4-nitrophenyl)ethyl]piperidin-4-yl]-5,5-diphenylimidazol-4-one |
|---|---|
| PubChem CID | 10031442 |
| Molecular Formula | C29H30N4O3 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | 2-methyl-3-[1-[2-(4-nitrophenyl)ethyl]piperidin-4-yl]-5,5-diphenylimidazol-4-one |
| SMILES | CC1=NC(c2ccccc2)(c2ccccc2)C(=O)N1C1CCN(CCc2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C29H30N4O3/c1-22-30-29(24-8-4-2-5-9-24,25-10-6-3-7-11-25)28(34)32(22)26-17-20-31(21-18-26)19-16-23-12-14-27(15-13-23)33(35)36/h2-15,26H,16-21H2,1H3 |
| InChIKey | RHCIIJJODZAABQ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 79.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|