C34H52F2N4OS — CID 10031534
1-[5-[(4,5-dicyclohexyl-1H-imidazol-2-yl)sulfanyl]pentyl]-3-(2,4-difluorophenyl)-1-heptylurea (PubChem CID 10031534) has the molecular formula C34H52F2N4OS and a molecular weight of 602.88 g/mol. Its IUPAC name is 1-[5-[(4,5-dicyclohexyl-1H-imidazol-2-yl)sulfanyl]pentyl]-3-(2,4-difluorophenyl)-1-heptylurea.
| Compound Name | 1-[5-[(4,5-dicyclohexyl-1H-imidazol-2-yl)sulfanyl]pentyl]-3-(2,4-difluorophenyl)-1-heptylurea |
|---|---|
| PubChem CID | 10031534 |
| Molecular Formula | C34H52F2N4OS |
| Molecular Weight | 602.88 g/mol |
| Exact Mass | 602.38 |
| IUPAC Name | 1-[5-[(4,5-dicyclohexyl-1H-imidazol-2-yl)sulfanyl]pentyl]-3-(2,4-difluorophenyl)-1-heptylurea |
| SMILES | CCCCCCCN(CCCCCSc1nc(C2CCCCC2)c(C2CCCCC2)[nH]1)C(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C34H52F2N4OS/c1-2-3-4-5-13-22-40(34(41)37-30-21-20-28(35)25-29(30)36)23-14-8-15-24-42-33-38-31(26-16-9-6-10-17-26)32(39-33)27-18-11-7-12-19-27/h20-21,25-27H,2-19,22-24H2,1H3,(H,37,41)(H,38,39) |
| InChIKey | GBQPRLAUUSZJCR-UHFFFAOYSA-N |
| XLogP | 10.55 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.88 |
| LogP ≤ 5 | 10.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|