C37H52O5Si — CID 10031567
[(3aS,4S,5S,9bR)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2,5-trimethyl-4,6,7,8,9,9b-hexahydro-3aH-benzo[e][1,3]benzodioxol-4-yl]methyl 2,2-dimethylpropanoate (PubChem CID 10031567) has the molecular formula C37H52O5Si and a molecular weight of 604.90 g/mol. Its IUPAC name is [(3aS,4S,5S,9bR)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2,5-trimethyl-4,6,7,8,9,9b-hexahydro-3aH-benzo[e][1,3]benzodioxol-4-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(3aS,4S,5S,9bR)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2,5-trimethyl-4,6,7,8,9,9b-hexahydro-3aH-benzo[e][1,3]benzodioxol-4-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10031567 |
| Molecular Formula | C37H52O5Si |
| Molecular Weight | 604.90 g/mol |
| Exact Mass | 604.36 |
| IUPAC Name | [(3aS,4S,5S,9bR)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2,5-trimethyl-4,6,7,8,9,9b-hexahydro-3aH-benzo[e][1,3]benzodioxol-4-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)C1=C(CCCC1)[C@@](C)(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H]2COC(=O)C(C)(C)C |
| InChI | InChI=1S/C37H52O5Si/c1-34(2,3)33(38)39-24-30-32-31(41-36(7,8)42-32)28-22-16-17-23-29(28)37(30,9)25-40-43(35(4,5)6,26-18-12-10-13-19-26)27-20-14-11-15-21-27/h10-15,18-21,30-32H,16-17,22-25H2,1-9H3/t30-,31+,32-,37+/m0/s1 |
| InChIKey | VZOJXUNEFNCTHL-AWYYSMRRSA-N |
| XLogP | 7.18 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.90 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|