C35H46N2O7 — CID 10031589
5,10,15-trimethyl-22,25,30,33-tetraoxa-1,19-diazapentacyclo[17.8.8.13,7.18,12.113,17]octatriaconta-3(38),4,6,8,10,12(37),13,15,17(36)-nonaene-36,37,38-triol (PubChem CID 10031589) has the molecular formula C35H46N2O7 and a molecular weight of 606.76 g/mol. Its IUPAC name is 5,10,15-trimethyl-22,25,30,33-tetraoxa-1,19-diazapentacyclo[17.8.8.13,7.18,12.113,17]octatriaconta-3(38),4,6,8,10,12(37),13,15,17(36)-nonaene-36,37,38-triol.
| Compound Name | 5,10,15-trimethyl-22,25,30,33-tetraoxa-1,19-diazapentacyclo[17.8.8.13,7.18,12.113,17]octatriaconta-3(38),4,6,8,10,12(37),13,15,17(36)-nonaene-36,37,38-triol |
|---|---|
| PubChem CID | 10031589 |
| Molecular Formula | C35H46N2O7 |
| Molecular Weight | 606.76 g/mol |
| Exact Mass | 606.33 |
| IUPAC Name | 5,10,15-trimethyl-22,25,30,33-tetraoxa-1,19-diazapentacyclo[17.8.8.13,7.18,12.113,17]octatriaconta-3(38),4,6,8,10,12(37),13,15,17(36)-nonaene-36,37,38-triol |
| SMILES | Cc1cc2c(O)c(c1)-c1cc(C)cc(c1O)-c1cc(C)cc(c1O)CN1CCOCCOCCN(CCOCCOCC1)C2 |
| InChI | InChI=1S/C35H46N2O7/c1-24-16-27-22-36-4-8-41-12-14-43-10-6-37(7-11-44-15-13-42-9-5-36)23-28-17-25(2)19-30(34(28)39)32-21-26(3)20-31(35(32)40)29(18-24)33(27)38/h16-21,38-40H,4-15,22-23H2,1-3H3 |
| InChIKey | LXBSRMALFTVKQX-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 104.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.76 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|