C32H55NO9Si — CID 10031885
(E,2R,3R,6S,7R,8S,10S,11R)-3-[tert-butyl(dimethyl)silyl]oxy-11-(2,5-dimethoxy-3-nitrophenyl)-7,8,11-trimethoxy-2,4,6,10-tetramethylundec-4-enal (PubChem CID 10031885) has the molecular formula C32H55NO9Si and a molecular weight of 625.88 g/mol. Its IUPAC name is (E,2R,3R,6S,7R,8S,10S,11R)-3-[tert-butyl(dimethyl)silyl]oxy-11-(2,5-dimethoxy-3-nitrophenyl)-7,8,11-trimethoxy-2,4,6,10-tetramethylundec-4-enal.
| Compound Name | (E,2R,3R,6S,7R,8S,10S,11R)-3-[tert-butyl(dimethyl)silyl]oxy-11-(2,5-dimethoxy-3-nitrophenyl)-7,8,11-trimethoxy-2,4,6,10-tetramethylundec-4-enal |
|---|---|
| PubChem CID | 10031885 |
| Molecular Formula | C32H55NO9Si |
| Molecular Weight | 625.88 g/mol |
| Exact Mass | 625.36 |
| IUPAC Name | (E,2R,3R,6S,7R,8S,10S,11R)-3-[tert-butyl(dimethyl)silyl]oxy-11-(2,5-dimethoxy-3-nitrophenyl)-7,8,11-trimethoxy-2,4,6,10-tetramethylundec-4-enal |
| SMILES | COc1cc([C@H](OC)[C@@H](C)C[C@H](OC)[C@H](OC)[C@@H](C)/C=C(\C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C=O)c(OC)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C32H55NO9Si/c1-20(28(23(4)19-34)42-43(13,14)32(5,6)7)15-21(2)30(40-11)27(38-9)16-22(3)29(39-10)25-17-24(37-8)18-26(33(35)36)31(25)41-12/h15,17-19,21-23,27-30H,16H2,1-14H3/b20-15+/t21-,22-,23-,27-,28-,29+,30+/m0/s1 |
| InChIKey | ZYVROXPQPMDTPO-CEYWASFVSA-N |
| XLogP | 7.16 |
| TPSA | 115.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.88 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|