C35H29N7O3S — CID 10031911
6-(4-benzylpiperazin-1-yl)-11-ethoxy-4-(2-nitrophenyl)-13-phenyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-12-carbonitrile (PubChem CID 10031911) has the molecular formula C35H29N7O3S and a molecular weight of 627.73 g/mol. Its IUPAC name is 6-(4-benzylpiperazin-1-yl)-11-ethoxy-4-(2-nitrophenyl)-13-phenyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-12-carbonitrile.
| Compound Name | 6-(4-benzylpiperazin-1-yl)-11-ethoxy-4-(2-nitrophenyl)-13-phenyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-12-carbonitrile |
|---|---|
| PubChem CID | 10031911 |
| Molecular Formula | C35H29N7O3S |
| Molecular Weight | 627.73 g/mol |
| Exact Mass | 627.21 |
| IUPAC Name | 6-(4-benzylpiperazin-1-yl)-11-ethoxy-4-(2-nitrophenyl)-13-phenyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-12-carbonitrile |
| SMILES | CCOc1nc2sc3c(N4CCN(Cc5ccccc5)CC4)nc(-c4ccccc4[N+](=O)[O-])nc3c2c(-c2ccccc2)c1C#N |
| InChI | InChI=1S/C35H29N7O3S/c1-2-45-34-26(21-36)28(24-13-7-4-8-14-24)29-30-31(46-35(29)39-34)33(38-32(37-30)25-15-9-10-16-27(25)42(43)44)41-19-17-40(18-20-41)22-23-11-5-3-6-12-23/h3-16H,2,17-20,22H2,1H3 |
| InChIKey | MKIYWAYJQMCRGC-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 121.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.73 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|