C30H35F6N5O2 — CID 10032161
5-[[3-[[[3,5-bis(trifluoromethyl)phenyl]methyl-(1-methyl-1,2,4-triazol-3-yl)amino]methyl]-5,6,7,8-tetrahydronaphthalen-2-yl]-ethylamino]pentanoic acid (PubChem CID 10032161) has the molecular formula C30H35F6N5O2 and a molecular weight of 611.63 g/mol. Its IUPAC name is 5-[[3-[[[3,5-bis(trifluoromethyl)phenyl]methyl-(1-methyl-1,2,4-triazol-3-yl)amino]methyl]-5,6,7,8-tetrahydronaphthalen-2-yl]-ethylamino]pentanoic acid.
| Compound Name | 5-[[3-[[[3,5-bis(trifluoromethyl)phenyl]methyl-(1-methyl-1,2,4-triazol-3-yl)amino]methyl]-5,6,7,8-tetrahydronaphthalen-2-yl]-ethylamino]pentanoic acid |
|---|---|
| PubChem CID | 10032161 |
| Molecular Formula | C30H35F6N5O2 |
| Molecular Weight | 611.63 g/mol |
| Exact Mass | 611.27 |
| IUPAC Name | 5-[[3-[[[3,5-bis(trifluoromethyl)phenyl]methyl-(1-methyl-1,2,4-triazol-3-yl)amino]methyl]-5,6,7,8-tetrahydronaphthalen-2-yl]-ethylamino]pentanoic acid |
| SMILES | CCN(CCCCC(=O)O)c1cc2c(cc1CN(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ncn(C)n1)CCCC2 |
| InChI | InChI=1S/C30H35F6N5O2/c1-3-40(11-7-6-10-27(42)43)26-15-22-9-5-4-8-21(22)14-23(26)18-41(28-37-19-39(2)38-28)17-20-12-24(29(31,32)33)16-25(13-20)30(34,35)36/h12-16,19H,3-11,17-18H2,1-2H3,(H,42,43) |
| InChIKey | QMLWQXYADHWIIY-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.63 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|