C38H36ClF3N2O3 — CID 10032634
2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]-N-(furan-2-ylmethyl)acetamide (PubChem CID 10032634) has the molecular formula C38H36ClF3N2O3 and a molecular weight of 661.16 g/mol. Its IUPAC name is 2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]-N-(furan-2-ylmethyl)acetamide.
| Compound Name | 2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 10032634 |
| Molecular Formula | C38H36ClF3N2O3 |
| Molecular Weight | 661.16 g/mol |
| Exact Mass | 660.24 |
| IUPAC Name | 2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]-N-(furan-2-ylmethyl)acetamide |
| SMILES | O=C(Cc1cccc(OCCCN(Cc2cccc(C(F)(F)F)c2Cl)CC(c2ccccc2)c2ccccc2)c1)NCc1ccco1 |
| InChI | InChI=1S/C38H36ClF3N2O3/c39-37-31(16-8-19-35(37)38(40,41)42)26-44(27-34(29-12-3-1-4-13-29)30-14-5-2-6-15-30)20-10-22-46-32-17-7-11-28(23-32)24-36(45)43-25-33-18-9-21-47-33/h1-9,11-19,21,23,34H,10,20,22,24-27H2,(H,43,45) |
| InChIKey | RBFMRFYPOLGLOE-UHFFFAOYSA-N |
| XLogP | 8.91 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.16 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|