C36H38F6N4O4 — CID 10032694
[3,5-bis(trifluoromethyl)phenyl]methyl (3R,6S,9aS)-6-(4-aminobutyl)-8-benzyl-3-[(4-methylphenyl)methyl]-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate (PubChem CID 10032694) has the molecular formula C36H38F6N4O4 and a molecular weight of 704.71 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl]methyl (3R,6S,9aS)-6-(4-aminobutyl)-8-benzyl-3-[(4-methylphenyl)methyl]-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl]methyl (3R,6S,9aS)-6-(4-aminobutyl)-8-benzyl-3-[(4-methylphenyl)methyl]-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate |
|---|---|
| PubChem CID | 10032694 |
| Molecular Formula | C36H38F6N4O4 |
| Molecular Weight | 704.71 g/mol |
| Exact Mass | 704.28 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]methyl (3R,6S,9aS)-6-(4-aminobutyl)-8-benzyl-3-[(4-methylphenyl)methyl]-4,7-dioxo-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate |
| SMILES | Cc1ccc(C[C@@H]2CN(C(=O)OCc3cc(C(F)(F)F)cc(C(F)(F)F)c3)[C@H]3CN(Cc4ccccc4)C(=O)[C@H](CCCCN)N3C2=O)cc1 |
| InChI | InChI=1S/C36H38F6N4O4/c1-23-10-12-24(13-11-23)15-27-20-45(34(49)50-22-26-16-28(35(37,38)39)18-29(17-26)36(40,41)42)31-21-44(19-25-7-3-2-4-8-25)33(48)30(9-5-6-14-43)46(31)32(27)47/h2-4,7-8,10-13,16-18,27,30-31H,5-6,9,14-15,19-22,43H2,1H3/t27-,30+,31-/m1/s1 |
| InChIKey | QLMRSXDUMJGUKP-JMJMSVOMSA-N |
| XLogP | 6.54 |
| TPSA | 96.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.71 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|