C41H66O11 — CID 10032891
(3E,5E,7E,9E,11E,13E,33E)-36-butan-2-yl-16,18,20,22,24,26,28,30,32-nonahydroxy-17,35-dimethyl-1-oxacyclohexatriaconta-3,5,7,9,11,13,33-heptaen-2-one (PubChem CID 10032891) has the molecular formula C41H66O11 and a molecular weight of 734.97 g/mol. Its IUPAC name is (3E,5E,7E,9E,11E,13E,33E)-36-butan-2-yl-16,18,20,22,24,26,28,30,32-nonahydroxy-17,35-dimethyl-1-oxacyclohexatriaconta-3,5,7,9,11,13,33-heptaen-2-one.
| Compound Name | (3E,5E,7E,9E,11E,13E,33E)-36-butan-2-yl-16,18,20,22,24,26,28,30,32-nonahydroxy-17,35-dimethyl-1-oxacyclohexatriaconta-3,5,7,9,11,13,33-heptaen-2-one |
|---|---|
| PubChem CID | 10032891 |
| Molecular Formula | C41H66O11 |
| Molecular Weight | 734.97 g/mol |
| Exact Mass | 734.46 |
| IUPAC Name | (3E,5E,7E,9E,11E,13E,33E)-36-butan-2-yl-16,18,20,22,24,26,28,30,32-nonahydroxy-17,35-dimethyl-1-oxacyclohexatriaconta-3,5,7,9,11,13,33-heptaen-2-one |
| SMILES | CCC(C)C1OC(=O)/C=C/C=C/C=C/C=C/C=C/C=C/CC(O)C(C)C(O)CC(O)CC(O)CC(O)CC(O)CC(O)CC(O)CC(O)/C=C/C1C |
| InChI | InChI=1S/C41H66O11/c1-5-28(2)41-29(3)19-20-31(42)21-32(43)22-33(44)23-34(45)24-35(46)25-36(47)26-37(48)27-39(50)30(4)38(49)17-15-13-11-9-7-6-8-10-12-14-16-18-40(51)52-41/h6-16,18-20,28-39,41-50H,5,17,21-27H2,1-4H3/b7-6+,10-8+,11-9+,14-12+,15-13+,18-16+,20-19+ |
| InChIKey | VRTOYGUQNUQDJB-AXJPMYATSA-N |
| XLogP | 3.49 |
| TPSA | 208.37 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.97 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|