C33H44Cl2N8O5S — CID 10032895
2-[(5S)-5-amino-6-[4-[2-[[2,4-dichloro-3-[(2,4-dimethylquinolin-8-yl)oxymethyl]phenyl]sulfonylamino]-2-methylpropanoyl]piperazin-1-yl]-6-oxohexyl]guanidine (PubChem CID 10032895) has the molecular formula C33H44Cl2N8O5S and a molecular weight of 735.74 g/mol. Its IUPAC name is 2-[(5S)-5-amino-6-[4-[2-[[2,4-dichloro-3-[(2,4-dimethylquinolin-8-yl)oxymethyl]phenyl]sulfonylamino]-2-methylpropanoyl]piperazin-1-yl]-6-oxohexyl]guanidine.
| Compound Name | 2-[(5S)-5-amino-6-[4-[2-[[2,4-dichloro-3-[(2,4-dimethylquinolin-8-yl)oxymethyl]phenyl]sulfonylamino]-2-methylpropanoyl]piperazin-1-yl]-6-oxohexyl]guanidine |
|---|---|
| PubChem CID | 10032895 |
| Molecular Formula | C33H44Cl2N8O5S |
| Molecular Weight | 735.74 g/mol |
| Exact Mass | 734.25 |
| IUPAC Name | 2-[(5S)-5-amino-6-[4-[2-[[2,4-dichloro-3-[(2,4-dimethylquinolin-8-yl)oxymethyl]phenyl]sulfonylamino]-2-methylpropanoyl]piperazin-1-yl]-6-oxohexyl]guanidine |
| SMILES | Cc1cc(C)c2cccc(OCc3c(Cl)ccc(S(=O)(=O)NC(C)(C)C(=O)N4CCN(C(=O)[C@@H](N)CCCCN=C(N)N)CC4)c3Cl)c2n1 |
| InChI | InChI=1S/C33H44Cl2N8O5S/c1-20-18-21(2)40-29-22(20)8-7-10-26(29)48-19-23-24(34)11-12-27(28(23)35)49(46,47)41-33(3,4)31(45)43-16-14-42(15-17-43)30(44)25(36)9-5-6-13-39-32(37)38/h7-8,10-12,18,25,41H,5-6,9,13-17,19,36H2,1-4H3,(H4,37,38,39)/t25-/m0/s1 |
| InChIKey | MEAFUDSYUNUCEX-VWLOTQADSA-N |
| XLogP | 3.24 |
| TPSA | 199.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.74 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|