C43H54O7Si2 — CID 10032920
methyl (4R)-4-[tert-butyl(diphenyl)silyl]oxy-4-[(4R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxobutanoate (PubChem CID 10032920) has the molecular formula C43H54O7Si2 and a molecular weight of 739.07 g/mol. Its IUPAC name is methyl (4R)-4-[tert-butyl(diphenyl)silyl]oxy-4-[(4R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxobutanoate.
| Compound Name | methyl (4R)-4-[tert-butyl(diphenyl)silyl]oxy-4-[(4R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxobutanoate |
|---|---|
| PubChem CID | 10032920 |
| Molecular Formula | C43H54O7Si2 |
| Molecular Weight | 739.07 g/mol |
| Exact Mass | 738.34 |
| IUPAC Name | methyl (4R)-4-[tert-butyl(diphenyl)silyl]oxy-4-[(4R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxobutanoate |
| SMILES | COC(=O)C(=O)C[C@@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H]1OC(C)(C)O[C@@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C43H54O7Si2/c1-41(2,3)51(32-22-14-10-15-23-32,33-24-16-11-17-25-33)47-31-38-39(49-43(7,8)48-38)37(30-36(44)40(45)46-9)50-52(42(4,5)6,34-26-18-12-19-27-34)35-28-20-13-21-29-35/h10-29,37-39H,30-31H2,1-9H3/t37-,38-,39+/m1/s1 |
| InChIKey | XKEBUETXCKQDRU-PHAUOLPESA-N |
| XLogP | 6.16 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.07 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|