C49H38N4O5 — CID 10033368
5,10,15,20-tetrakis(4-methoxyphenyl)-21,22-dihydroporphyrin-2-carbaldehyde (PubChem CID 10033368) has the molecular formula C49H38N4O5 and a molecular weight of 762.87 g/mol. Its IUPAC name is 5,10,15,20-tetrakis(4-methoxyphenyl)-21,22-dihydroporphyrin-2-carbaldehyde.
| Compound Name | 5,10,15,20-tetrakis(4-methoxyphenyl)-21,22-dihydroporphyrin-2-carbaldehyde |
|---|---|
| PubChem CID | 10033368 |
| Molecular Formula | C49H38N4O5 |
| Molecular Weight | 762.87 g/mol |
| Exact Mass | 762.28 |
| IUPAC Name | 5,10,15,20-tetrakis(4-methoxyphenyl)-21,22-dihydroporphyrin-2-carbaldehyde |
| SMILES | COc1ccc(-c2c3nc(c(-c4ccc(OC)cc4)c4ccc([nH]4)c(-c4ccc(OC)cc4)c4cc(C=O)c([nH]4)c(-c4ccc(OC)cc4)c4nc2C=C4)C=C3)cc1 |
| InChI | InChI=1S/C49H38N4O5/c1-55-34-13-5-29(6-14-34)45-38-21-22-39(50-38)46(30-7-15-35(56-2)16-8-30)41-25-26-43(52-41)48(32-11-19-37(58-4)20-12-32)49-33(28-54)27-44(53-49)47(42-24-23-40(45)51-42)31-9-17-36(57-3)18-10-31/h5-28,51,53H,1-4H3/b45-38-,45-40-,46-39-,46-41-,47-42-,47-44-,48-43-,49-48- |
| InChIKey | RBWZRNIJAFBGNW-AWUUXPGOSA-N |
| XLogP | 11.17 |
| TPSA | 111.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.87 |
| LogP ≤ 5 | 11.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|