C60H86N4O4 — CID 10033774
[1-[6-[8-[6-[4-(2,2-diphenylacetyl)oxypiperidin-1-yl]hexyl-methylamino]octyl-methylamino]hexyl]piperidin-4-yl] 2,2-diphenylacetate (PubChem CID 10033774) has the molecular formula C60H86N4O4 and a molecular weight of 927.37 g/mol. Its IUPAC name is [1-[6-[8-[6-[4-(2,2-diphenylacetyl)oxypiperidin-1-yl]hexyl-methylamino]octyl-methylamino]hexyl]piperidin-4-yl] 2,2-diphenylacetate.
| Compound Name | [1-[6-[8-[6-[4-(2,2-diphenylacetyl)oxypiperidin-1-yl]hexyl-methylamino]octyl-methylamino]hexyl]piperidin-4-yl] 2,2-diphenylacetate |
|---|---|
| PubChem CID | 10033774 |
| Molecular Formula | C60H86N4O4 |
| Molecular Weight | 927.37 g/mol |
| Exact Mass | 926.66 |
| IUPAC Name | [1-[6-[8-[6-[4-(2,2-diphenylacetyl)oxypiperidin-1-yl]hexyl-methylamino]octyl-methylamino]hexyl]piperidin-4-yl] 2,2-diphenylacetate |
| SMILES | CN(CCCCCCCCN(C)CCCCCCN1CCC(OC(=O)C(c2ccccc2)c2ccccc2)CC1)CCCCCCN1CCC(OC(=O)C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C60H86N4O4/c1-61(43-25-7-9-27-45-63-47-37-55(38-48-63)67-59(65)57(51-29-15-11-16-30-51)52-31-17-12-18-32-52)41-23-5-3-4-6-24-42-62(2)44-26-8-10-28-46-64-49-39-56(40-50-64)68-60(66)58(53-33-19-13-20-34-53)54-35-21-14-22-36-54/h11-22,29-36,55-58H,3-10,23-28,37-50H2,1-2H3 |
| InChIKey | YYSVGDFPWCNCAT-UHFFFAOYSA-N |
| XLogP | 11.99 |
| TPSA | 65.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 927.37 |
| LogP ≤ 5 | 11.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|