About 5,5-difluorocyclopenta-1,3-diene
5,5-difluorocyclopenta-1,3-diene (PubChem CID 10034589) has the molecular formula C5H4F2
and a molecular weight of 102.08 g/mol. Its IUPAC name is 5,5-difluorocyclopenta-1,3-diene.
Molecular Properties
| Compound Name | 5,5-difluorocyclopenta-1,3-diene |
| PubChem CID | 10034589 |
| Molecular Formula | C5H4F2 |
| Molecular Weight | 102.08 g/mol |
| Exact Mass | 102.03 |
| IUPAC Name | 5,5-difluorocyclopenta-1,3-diene |
| SMILES | FC1(F)C=CC=C1 |
| InChI | InChI=1S/C5H4F2/c6-5(7)3-1-2-4-5/h1-4H |
| InChIKey | ZTXWCIWMKJOURT-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.08 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 5,5-difluorocyclopenta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-difluorocyclopenta-1,3-diene?
The IUPAC name of 5,5-difluorocyclopenta-1,3-diene (CID 10034589) is 5,5-difluorocyclopenta-1,3-diene.
What is the SMILES notation for 5,5-difluorocyclopenta-1,3-diene?
The canonical SMILES for 5,5-difluorocyclopenta-1,3-diene is FC1(F)C=CC=C1.
What is the InChIKey of 5,5-difluorocyclopenta-1,3-diene?
The InChIKey is ZTXWCIWMKJOURT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4F2/c6-5(7)3-1-2-4-5/h1-4H.
What are the key properties of 5,5-difluorocyclopenta-1,3-diene?
5,5-difluorocyclopenta-1,3-diene has a molecular weight of 102.08 g/mol, XLogP of 1.75, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-difluorocyclopenta-1,3-diene is sourced from PubChem (CID 10034589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).