About 2,3-dihydro-1H-indol-5-ol
2,3-dihydro-1H-indol-5-ol (PubChem CID 10034684) has the molecular formula C8H9NO
and a molecular weight of 135.17 g/mol. Its IUPAC name is 2,3-dihydro-1H-indol-5-ol.
Molecular Properties
| Compound Name | 2,3-dihydro-1H-indol-5-ol |
| PubChem CID | 10034684 |
| Molecular Formula | C8H9NO |
| Molecular Weight | 135.17 g/mol |
| Exact Mass | 135.07 |
| IUPAC Name | 2,3-dihydro-1H-indol-5-ol |
| SMILES | Oc1ccc2c(c1)CCN2 |
| InChI | InChI=1S/C8H9NO/c10-7-1-2-8-6(5-7)3-4-9-8/h1-2,5,9-10H,3-4H2 |
| InChIKey | MPCXQPXCYDDJSR-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.17 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dihydro-1H-indol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-1H-indol-5-ol?
The IUPAC name of 2,3-dihydro-1H-indol-5-ol (CID 10034684) is 2,3-dihydro-1H-indol-5-ol.
What is the SMILES notation for 2,3-dihydro-1H-indol-5-ol?
The canonical SMILES for 2,3-dihydro-1H-indol-5-ol is Oc1ccc2c(c1)CCN2.
What is the InChIKey of 2,3-dihydro-1H-indol-5-ol?
The InChIKey is MPCXQPXCYDDJSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO/c10-7-1-2-8-6(5-7)3-4-9-8/h1-2,5,9-10H,3-4H2.
What are the key properties of 2,3-dihydro-1H-indol-5-ol?
2,3-dihydro-1H-indol-5-ol has a molecular weight of 135.17 g/mol, XLogP of 1.36, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1H-indol-5-ol is sourced from PubChem (CID 10034684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).