About 1,6-anhydro-3,4-dideoxy-4-methyl-beta-D-glycero-hex-3-enopyranos-2-ulose
1,6-anhydro-3,4-dideoxy-4-methyl-beta-D-glycero-hex-3-enopyranos-2-ulose (PubChem CID 10034698) has the molecular formula C7H8O3
and a molecular weight of 140.14 g/mol. Its IUPAC name is (1S,5R)-2-methyl-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one.
Molecular Properties
| Compound Name | 1,6-anhydro-3,4-dideoxy-4-methyl-beta-D-glycero-hex-3-enopyranos-2-ulose |
| PubChem CID | 10034698 |
| Molecular Formula | C7H8O3 |
| Molecular Weight | 140.14 g/mol |
| Exact Mass | 140.05 |
| IUPAC Name | (1S,5R)-2-methyl-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one |
| SMILES | CC1=CC(=O)[C@@H]2OC[C@H]1O2 |
| InChI | InChI=1S/C7H8O3/c1-4-2-5(8)7-9-3-6(4)10-7/h2,6-7H,3H2,1H3/t6-,7-/m1/s1 |
| InChIKey | GKZKCTWRLLFBAF-RNFRBKRXSA-N |
| XLogP | -0.30 |
| TPSA | 35.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | 207 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.14 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,6-anhydro-3,4-dideoxy-4-methyl-beta-D-glycero-hex-3-enopyranos-2-ulose with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-anhydro-3,4-dideoxy-4-methyl-beta-D-glycero-hex-3-enopyranos-2-ulose?
The IUPAC name of 1,6-anhydro-3,4-dideoxy-4-methyl-beta-D-glycero-hex-3-enopyranos-2-ulose (CID 10034698) is (1S,5R)-2-methyl-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one.
What is the SMILES notation for 1,6-anhydro-3,4-dideoxy-4-methyl-beta-D-glycero-hex-3-enopyranos-2-ulose?
The canonical SMILES for 1,6-anhydro-3,4-dideoxy-4-methyl-beta-D-glycero-hex-3-enopyranos-2-ulose is CC1=CC(=O)[C@@H]2OC[C@H]1O2.
What is the InChIKey of 1,6-anhydro-3,4-dideoxy-4-methyl-beta-D-glycero-hex-3-enopyranos-2-ulose?
The InChIKey is GKZKCTWRLLFBAF-RNFRBKRXSA-N. The full InChI is InChI=1S/C7H8O3/c1-4-2-5(8)7-9-3-6(4)10-7/h2,6-7H,3H2,1H3/t6-,7-/m1/s1.
What are the key properties of 1,6-anhydro-3,4-dideoxy-4-methyl-beta-D-glycero-hex-3-enopyranos-2-ulose?
1,6-anhydro-3,4-dideoxy-4-methyl-beta-D-glycero-hex-3-enopyranos-2-ulose has a molecular weight of 140.14 g/mol, XLogP of -0.30, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-anhydro-3,4-dideoxy-4-methyl-beta-D-glycero-hex-3-enopyranos-2-ulose is sourced from PubChem (CID 10034698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).