About 5-(furan-2-yl)-1H-1,2,4-triazol-3-amine
5-(furan-2-yl)-1H-1,2,4-triazol-3-amine (PubChem CID 10034780) has the molecular formula C6H6N4O
and a molecular weight of 150.14 g/mol. Its IUPAC name is 5-(furan-2-yl)-1H-1,2,4-triazol-3-amine.
Molecular Properties
| Compound Name | 5-(furan-2-yl)-1H-1,2,4-triazol-3-amine |
| PubChem CID | 10034780 |
| Molecular Formula | C6H6N4O |
| Molecular Weight | 150.14 g/mol |
| Exact Mass | 150.05 |
| IUPAC Name | 5-(furan-2-yl)-1H-1,2,4-triazol-3-amine |
| SMILES | Nc1n[nH]c(-c2ccco2)n1 |
| InChI | InChI=1S/C6H6N4O/c7-6-8-5(9-10-6)4-2-1-3-11-4/h1-3H,(H3,7,8,9,10) |
| InChIKey | PXCDIRKSCUAMKA-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 80.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.14 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(furan-2-yl)-1H-1,2,4-triazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(furan-2-yl)-1H-1,2,4-triazol-3-amine?
The IUPAC name of 5-(furan-2-yl)-1H-1,2,4-triazol-3-amine (CID 10034780) is 5-(furan-2-yl)-1H-1,2,4-triazol-3-amine.
What is the SMILES notation for 5-(furan-2-yl)-1H-1,2,4-triazol-3-amine?
The canonical SMILES for 5-(furan-2-yl)-1H-1,2,4-triazol-3-amine is Nc1n[nH]c(-c2ccco2)n1.
What is the InChIKey of 5-(furan-2-yl)-1H-1,2,4-triazol-3-amine?
The InChIKey is PXCDIRKSCUAMKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4O/c7-6-8-5(9-10-6)4-2-1-3-11-4/h1-3H,(H3,7,8,9,10).
What are the key properties of 5-(furan-2-yl)-1H-1,2,4-triazol-3-amine?
5-(furan-2-yl)-1H-1,2,4-triazol-3-amine has a molecular weight of 150.14 g/mol, XLogP of 0.65, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(furan-2-yl)-1H-1,2,4-triazol-3-amine is sourced from PubChem (CID 10034780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).