About 2-ethoxy-1,3,2λ5-dioxaphospholane 2-oxide
2-ethoxy-1,3,2λ5-dioxaphospholane 2-oxide (PubChem CID 10034799) has the molecular formula C4H9O4P
and a molecular weight of 152.09 g/mol. Its IUPAC name is 2-ethoxy-1,3,2λ5-dioxaphospholane 2-oxide.
Molecular Properties
| Compound Name | 2-ethoxy-1,3,2λ5-dioxaphospholane 2-oxide |
| PubChem CID | 10034799 |
| Molecular Formula | C4H9O4P |
| Molecular Weight | 152.09 g/mol |
| Exact Mass | 152.02 |
| IUPAC Name | 2-ethoxy-1,3,2λ5-dioxaphospholane 2-oxide |
| SMILES | CCOP1(=O)OCCO1 |
| InChI | InChI=1S/C4H9O4P/c1-2-6-9(5)7-3-4-8-9/h2-4H2,1H3 |
| InChIKey | IUVGGESEBFJHPK-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.09 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxy-1,3,2λ5-dioxaphospholane 2-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-1,3,2λ5-dioxaphospholane 2-oxide?
The IUPAC name of 2-ethoxy-1,3,2λ5-dioxaphospholane 2-oxide (CID 10034799) is 2-ethoxy-1,3,2λ5-dioxaphospholane 2-oxide.
What is the SMILES notation for 2-ethoxy-1,3,2λ5-dioxaphospholane 2-oxide?
The canonical SMILES for 2-ethoxy-1,3,2λ5-dioxaphospholane 2-oxide is CCOP1(=O)OCCO1.
What is the InChIKey of 2-ethoxy-1,3,2λ5-dioxaphospholane 2-oxide?
The InChIKey is IUVGGESEBFJHPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9O4P/c1-2-6-9(5)7-3-4-8-9/h2-4H2,1H3.
What are the key properties of 2-ethoxy-1,3,2λ5-dioxaphospholane 2-oxide?
2-ethoxy-1,3,2λ5-dioxaphospholane 2-oxide has a molecular weight of 152.09 g/mol, XLogP of 1.18, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-1,3,2λ5-dioxaphospholane 2-oxide is sourced from PubChem (CID 10034799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).