About 1-methylpyrazolo[1,5-a]indole
1-methylpyrazolo[1,5-a]indole (PubChem CID 10035029) has the molecular formula C11H10N2
and a molecular weight of 170.21 g/mol. Its IUPAC name is 1-methylpyrazolo[1,5-a]indole.
Molecular Properties
| Compound Name | 1-methylpyrazolo[1,5-a]indole |
|---|
| PubChem CID | 10035029 |
|---|
| Molecular Formula | C11H10N2 |
|---|
| Molecular Weight | 170.21 g/mol |
|---|
| Exact Mass | 170.08 |
|---|
| IUPAC Name | 1-methylpyrazolo[1,5-a]indole |
|---|
| SMILES | Cn1ccc2cc3ccccc3n21 |
|---|
| InChI | InChI=1S/C11H10N2/c1-12-7-6-10-8-9-4-2-3-5-11(9)13(10)12/h2-8H,1H3 |
|---|
| InChIKey | DQPZPMASPBMISD-UHFFFAOYSA-N |
|---|
| XLogP | 2.43 |
|---|
| TPSA | 9.34 Ų |
|---|
| H-Bond Donors | |
|---|
| H-Bond Acceptors | 2 |
|---|
| Rotatable Bonds | |
|---|
| Heavy Atoms | 13 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methylpyrazolo[1,5-a]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylpyrazolo[1,5-a]indole?
The IUPAC name of 1-methylpyrazolo[1,5-a]indole (CID 10035029) is 1-methylpyrazolo[1,5-a]indole.
What is the SMILES notation for 1-methylpyrazolo[1,5-a]indole?
The canonical SMILES for 1-methylpyrazolo[1,5-a]indole is Cn1ccc2cc3ccccc3n21.
What is the InChIKey of 1-methylpyrazolo[1,5-a]indole?
The InChIKey is DQPZPMASPBMISD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2/c1-12-7-6-10-8-9-4-2-3-5-11(9)13(10)12/h2-8H,1H3.
What are the key properties of 1-methylpyrazolo[1,5-a]indole?
1-methylpyrazolo[1,5-a]indole has a molecular weight of 170.21 g/mol, XLogP of 2.43, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylpyrazolo[1,5-a]indole is sourced from PubChem (CID 10035029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).