About N'-amino-4-hydrazinyl-2,2-dimethyl-4-oxobutanimidamide
N'-amino-4-hydrazinyl-2,2-dimethyl-4-oxobutanimidamide (PubChem CID 10035076) has the molecular formula C6H15N5O
and a molecular weight of 173.22 g/mol. Its IUPAC name is N'-amino-4-hydrazinyl-2,2-dimethyl-4-oxobutanimidamide.
Molecular Properties
| Compound Name | N'-amino-4-hydrazinyl-2,2-dimethyl-4-oxobutanimidamide |
| PubChem CID | 10035076 |
| Molecular Formula | C6H15N5O |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.13 |
| IUPAC Name | N'-amino-4-hydrazinyl-2,2-dimethyl-4-oxobutanimidamide |
| SMILES | CC(C)(CC(=O)NN)/C(N)=N\N |
| InChI | InChI=1S/C6H15N5O/c1-6(2,5(7)11-9)3-4(12)10-8/h3,8-9H2,1-2H3,(H2,7,11)(H,10,12) |
| InChIKey | PHEHMSNEEFUSPM-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 119.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-amino-4-hydrazinyl-2,2-dimethyl-4-oxobutanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-amino-4-hydrazinyl-2,2-dimethyl-4-oxobutanimidamide?
The IUPAC name of N'-amino-4-hydrazinyl-2,2-dimethyl-4-oxobutanimidamide (CID 10035076) is N'-amino-4-hydrazinyl-2,2-dimethyl-4-oxobutanimidamide.
What is the SMILES notation for N'-amino-4-hydrazinyl-2,2-dimethyl-4-oxobutanimidamide?
The canonical SMILES for N'-amino-4-hydrazinyl-2,2-dimethyl-4-oxobutanimidamide is CC(C)(CC(=O)NN)/C(N)=N\N.
What is the InChIKey of N'-amino-4-hydrazinyl-2,2-dimethyl-4-oxobutanimidamide?
The InChIKey is PHEHMSNEEFUSPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N5O/c1-6(2,5(7)11-9)3-4(12)10-8/h3,8-9H2,1-2H3,(H2,7,11)(H,10,12).
What are the key properties of N'-amino-4-hydrazinyl-2,2-dimethyl-4-oxobutanimidamide?
N'-amino-4-hydrazinyl-2,2-dimethyl-4-oxobutanimidamide has a molecular weight of 173.22 g/mol, XLogP of -1.38, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-amino-4-hydrazinyl-2,2-dimethyl-4-oxobutanimidamide is sourced from PubChem (CID 10035076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).