About 3-methylpurine-2,6,8-trione
3-methylpurine-2,6,8-trione (PubChem CID 10035199) has the molecular formula C6H4N4O3
and a molecular weight of 180.12 g/mol. Its IUPAC name is 3-methylpurine-2,6,8-trione.
Molecular Properties
| Compound Name | 3-methylpurine-2,6,8-trione |
| PubChem CID | 10035199 |
| Molecular Formula | C6H4N4O3 |
| Molecular Weight | 180.12 g/mol |
| Exact Mass | 180.03 |
| IUPAC Name | 3-methylpurine-2,6,8-trione |
| SMILES | Cn1c(=O)[nH]c(=O)c2c1=NC(=O)N=2 |
| InChI | InChI=1S/C6H4N4O3/c1-10-3-2(7-5(12)8-3)4(11)9-6(10)13/h1H3,(H,9,11,13) |
| InChIKey | AEVIXGVYZJBOTB-UHFFFAOYSA-N |
| XLogP | -2.55 |
| TPSA | 96.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.12 |
| LogP ≤ 5 | -2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-methylpurine-2,6,8-trione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylpurine-2,6,8-trione?
The IUPAC name of 3-methylpurine-2,6,8-trione (CID 10035199) is 3-methylpurine-2,6,8-trione.
What is the SMILES notation for 3-methylpurine-2,6,8-trione?
The canonical SMILES for 3-methylpurine-2,6,8-trione is Cn1c(=O)[nH]c(=O)c2c1=NC(=O)N=2.
What is the InChIKey of 3-methylpurine-2,6,8-trione?
The InChIKey is AEVIXGVYZJBOTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N4O3/c1-10-3-2(7-5(12)8-3)4(11)9-6(10)13/h1H3,(H,9,11,13).
What are the key properties of 3-methylpurine-2,6,8-trione?
3-methylpurine-2,6,8-trione has a molecular weight of 180.12 g/mol, XLogP of -2.55, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylpurine-2,6,8-trione is sourced from PubChem (CID 10035199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).