About 7-chloro-1,4-dihydroquinazolin-2-amine
7-chloro-1,4-dihydroquinazolin-2-amine (PubChem CID 10035245) has the molecular formula C8H8ClN3
and a molecular weight of 181.63 g/mol. Its IUPAC name is 7-chloro-1,4-dihydroquinazolin-2-amine.
Molecular Properties
| Compound Name | 7-chloro-1,4-dihydroquinazolin-2-amine |
| PubChem CID | 10035245 |
| Molecular Formula | C8H8ClN3 |
| Molecular Weight | 181.63 g/mol |
| Exact Mass | 181.04 |
| IUPAC Name | 7-chloro-1,4-dihydroquinazolin-2-amine |
| SMILES | NC1=NCc2ccc(Cl)cc2N1 |
| InChI | InChI=1S/C8H8ClN3/c9-6-2-1-5-4-11-8(10)12-7(5)3-6/h1-3H,4H2,(H3,10,11,12) |
| InChIKey | KIJXVALDJPUIFM-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.63 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-chloro-1,4-dihydroquinazolin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-1,4-dihydroquinazolin-2-amine?
The IUPAC name of 7-chloro-1,4-dihydroquinazolin-2-amine (CID 10035245) is 7-chloro-1,4-dihydroquinazolin-2-amine.
What is the SMILES notation for 7-chloro-1,4-dihydroquinazolin-2-amine?
The canonical SMILES for 7-chloro-1,4-dihydroquinazolin-2-amine is NC1=NCc2ccc(Cl)cc2N1.
What is the InChIKey of 7-chloro-1,4-dihydroquinazolin-2-amine?
The InChIKey is KIJXVALDJPUIFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8ClN3/c9-6-2-1-5-4-11-8(10)12-7(5)3-6/h1-3H,4H2,(H3,10,11,12).
What are the key properties of 7-chloro-1,4-dihydroquinazolin-2-amine?
7-chloro-1,4-dihydroquinazolin-2-amine has a molecular weight of 181.63 g/mol, XLogP of 1.58, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-1,4-dihydroquinazolin-2-amine is sourced from PubChem (CID 10035245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).