C7H14BN2O3- — CID 10035330
(3S,6R)-5,5-dihydroxy-3-methyl-1,4-diaza-5-boranuidabicyclo[4.3.0]nonan-2-one (PubChem CID 10035330) has the molecular formula C7H14BN2O3- and a molecular weight of 185.01 g/mol. Its IUPAC name is (3S,6R)-5,5-dihydroxy-3-methyl-1,4-diaza-5-boranuidabicyclo[4.3.0]nonan-2-one.
| Compound Name | (3S,6R)-5,5-dihydroxy-3-methyl-1,4-diaza-5-boranuidabicyclo[4.3.0]nonan-2-one |
|---|---|
| PubChem CID | 10035330 |
| Molecular Formula | C7H14BN2O3- |
| Molecular Weight | 185.01 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | (3S,6R)-5,5-dihydroxy-3-methyl-1,4-diaza-5-boranuidabicyclo[4.3.0]nonan-2-one |
| SMILES | C[C@@H]1N[B-](O)(O)[C@@H]2CCCN2C1=O |
| InChI | InChI=1S/C7H14BN2O3/c1-5-7(11)10-4-2-3-6(10)8(12,13)9-5/h5-6,9,12-13H,2-4H2,1H3/q-1/t5-,6-/m0/s1 |
| InChIKey | XLWADBHTAZRIBM-WDSKDSINSA-N |
| XLogP | -1.57 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.01 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|