C11H11NS — CID 10035412
3-ethyl-5-phenyl-1,2-thiazole (PubChem CID 10035412) has the molecular formula C11H11NS and a molecular weight of 189.28 g/mol. Its IUPAC name is 3-ethyl-5-phenyl-1,2-thiazole.
| Compound Name | 3-ethyl-5-phenyl-1,2-thiazole |
|---|---|
| PubChem CID | 10035412 |
| Molecular Formula | C11H11NS |
| Molecular Weight | 189.28 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | 3-ethyl-5-phenyl-1,2-thiazole |
| SMILES | CCc1cc(-c2ccccc2)sn1 |
| InChI | InChI=1S/C11H11NS/c1-2-10-8-11(13-12-10)9-6-4-3-5-7-9/h3-8H,2H2,1H3 |
| InChIKey | BTCZWTMXUSZGPV-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.28 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |