About (2,5-dioxopyrrolidin-1-yl) N-propan-2-ylcarbamate
(2,5-dioxopyrrolidin-1-yl) N-propan-2-ylcarbamate (PubChem CID 10035669) has the molecular formula C8H12N2O4
and a molecular weight of 200.19 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) N-propan-2-ylcarbamate.
Molecular Properties
| Compound Name | (2,5-dioxopyrrolidin-1-yl) N-propan-2-ylcarbamate |
| PubChem CID | 10035669 |
| Molecular Formula | C8H12N2O4 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) N-propan-2-ylcarbamate |
| SMILES | CC(C)NC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C8H12N2O4/c1-5(2)9-8(13)14-10-6(11)3-4-7(10)12/h5H,3-4H2,1-2H3,(H,9,13) |
| InChIKey | KHAMNADHIXZMMY-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dioxopyrrolidin-1-yl) N-propan-2-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dioxopyrrolidin-1-yl) N-propan-2-ylcarbamate?
The IUPAC name of (2,5-dioxopyrrolidin-1-yl) N-propan-2-ylcarbamate (CID 10035669) is (2,5-dioxopyrrolidin-1-yl) N-propan-2-ylcarbamate.
What is the SMILES notation for (2,5-dioxopyrrolidin-1-yl) N-propan-2-ylcarbamate?
The canonical SMILES for (2,5-dioxopyrrolidin-1-yl) N-propan-2-ylcarbamate is CC(C)NC(=O)ON1C(=O)CCC1=O.
What is the InChIKey of (2,5-dioxopyrrolidin-1-yl) N-propan-2-ylcarbamate?
The InChIKey is KHAMNADHIXZMMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O4/c1-5(2)9-8(13)14-10-6(11)3-4-7(10)12/h5H,3-4H2,1-2H3,(H,9,13).
What are the key properties of (2,5-dioxopyrrolidin-1-yl) N-propan-2-ylcarbamate?
(2,5-dioxopyrrolidin-1-yl) N-propan-2-ylcarbamate has a molecular weight of 200.19 g/mol, XLogP of 0.19, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dioxopyrrolidin-1-yl) N-propan-2-ylcarbamate is sourced from PubChem (CID 10035669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).